C16H22O6 — CID 59855677
(4,5-diethoxy-3-hydroxyoxolan-2-yl)methyl benzoate (PubChem CID 59855677) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is (4,5-diethoxy-3-hydroxyoxolan-2-yl)methyl benzoate.
| Compound Name | (4,5-diethoxy-3-hydroxyoxolan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 59855677 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (4,5-diethoxy-3-hydroxyoxolan-2-yl)methyl benzoate |
| SMILES | CCOC1OC(COC(=O)c2ccccc2)C(O)C1OCC |
| InChI | InChI=1S/C16H22O6/c1-3-19-14-13(17)12(22-16(14)20-4-2)10-21-15(18)11-8-6-5-7-9-11/h5-9,12-14,16-17H,3-4,10H2,1-2H3 |
| InChIKey | HXPDOVGZFVFFSD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |