C54H46O17 — CID 126708393
[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[[(2R,3R,4S,5R,6R)-4,5-dibenzoyloxy-3,6-dihydroxyoxan-2-yl]methoxy]oxan-2-yl]methyl benzoate (PubChem CID 126708393) has the molecular formula C54H46O17 and a molecular weight of 966.95 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[[(2R,3R,4S,5R,6R)-4,5-dibenzoyloxy-3,6-dihydroxyoxan-2-yl]methoxy]oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[[(2R,3R,4S,5R,6R)-4,5-dibenzoyloxy-3,6-dihydroxyoxan-2-yl]methoxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 126708393 |
| Molecular Formula | C54H46O17 |
| Molecular Weight | 966.95 g/mol |
| Exact Mass | 966.27 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[[(2R,3R,4S,5R,6R)-4,5-dibenzoyloxy-3,6-dihydroxyoxan-2-yl]methoxy]oxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](O)[C@H](OC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@@H]2O)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H46O17/c55-41-39(65-53(62)45(70-51(60)37-27-15-5-16-28-37)43(41)68-49(58)35-23-11-3-12-24-35)31-64-54-46(71-52(61)38-29-17-6-18-30-38)44(69-50(59)36-25-13-4-14-26-36)42(67-48(57)34-21-9-2-10-22-34)40(66-54)32-63-47(56)33-19-7-1-8-20-33/h1-30,39-46,53-55,62H,31-32H2/t39-,40-,41-,42-,43+,44+,45-,46-,53-,54-/m1/s1 |
| InChIKey | GFNSPZSBKMRYIT-YBWLRKLZSA-N |
| XLogP | 5.79 |
| TPSA | 225.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 966.95 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|