C27H24O9 — CID 56619465
[(2R,3S,4S,5R,6S)-4,5-dibenzoyloxy-3,6-dihydroxyoxan-2-yl]methyl benzoate (PubChem CID 56619465) has the molecular formula C27H24O9 and a molecular weight of 492.48 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-4,5-dibenzoyloxy-3,6-dihydroxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6S)-4,5-dibenzoyloxy-3,6-dihydroxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 56619465 |
| Molecular Formula | C27H24O9 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-4,5-dibenzoyloxy-3,6-dihydroxyoxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@H](O)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C27H24O9/c28-21-20(16-33-24(29)17-10-4-1-5-11-17)34-27(32)23(36-26(31)19-14-8-3-9-15-19)22(21)35-25(30)18-12-6-2-7-13-18/h1-15,20-23,27-28,32H,16H2/t20-,21+,22+,23-,27+/m1/s1 |
| InChIKey | SQYQMKSXNQIIGQ-PUJHRNRVSA-N |
| XLogP | 2.37 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|