C19H17FO6 — CID 126567775
[(2R,3R,4S)-4-benzoyloxy-3-fluoro-5-hydroxyoxolan-2-yl]methyl benzoate (PubChem CID 126567775) has the molecular formula C19H17FO6 and a molecular weight of 360.34 g/mol. Its IUPAC name is [(2R,3R,4S)-4-benzoyloxy-3-fluoro-5-hydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S)-4-benzoyloxy-3-fluoro-5-hydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 126567775 |
| Molecular Formula | C19H17FO6 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [(2R,3R,4S)-4-benzoyloxy-3-fluoro-5-hydroxyoxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC(O)[C@H](OC(=O)c2ccccc2)[C@@H]1F)c1ccccc1 |
| InChI | InChI=1S/C19H17FO6/c20-15-14(11-24-17(21)12-7-3-1-4-8-12)25-19(23)16(15)26-18(22)13-9-5-2-6-10-13/h1-10,14-16,19,23H,11H2/t14-,15-,16-,19?/m1/s1 |
| InChIKey | VXKZZNHURZTSQV-OJEBHDCCSA-N |
| XLogP | 2.12 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |