C20H18FNO5S — CID 101345967
[(2R,3S,4S,5R)-4-benzoyloxy-5-carbamothioyl-3-fluorooxolan-2-yl]methyl benzoate (PubChem CID 101345967) has the molecular formula C20H18FNO5S and a molecular weight of 403.43 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-4-benzoyloxy-5-carbamothioyl-3-fluorooxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R)-4-benzoyloxy-5-carbamothioyl-3-fluorooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101345967 |
| Molecular Formula | C20H18FNO5S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | [(2R,3S,4S,5R)-4-benzoyloxy-5-carbamothioyl-3-fluorooxolan-2-yl]methyl benzoate |
| SMILES | NC(=S)[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@H](F)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18FNO5S/c21-15-14(11-25-19(23)12-7-3-1-4-8-12)26-17(18(22)28)16(15)27-20(24)13-9-5-2-6-10-13/h1-10,14-17H,11H2,(H2,22,28)/t14-,15+,16-,17-/m1/s1 |
| InChIKey | FBTQKFOWLOBCPU-YYIAUSFCSA-N |
| XLogP | 2.46 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|