C27H22BrFO7 — CID 67119991
[(2R,3R,4R,5R)-4,5-dibenzoyloxy-6-bromo-3-fluorooxan-2-yl]methyl benzoate (PubChem CID 67119991) has the molecular formula C27H22BrFO7 and a molecular weight of 557.37 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4,5-dibenzoyloxy-6-bromo-3-fluorooxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5R)-4,5-dibenzoyloxy-6-bromo-3-fluorooxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 67119991 |
| Molecular Formula | C27H22BrFO7 |
| Molecular Weight | 557.37 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | [(2R,3R,4R,5R)-4,5-dibenzoyloxy-6-bromo-3-fluorooxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC(Br)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1F)c1ccccc1 |
| InChI | InChI=1S/C27H22BrFO7/c28-24-23(36-27(32)19-14-8-3-9-15-19)22(35-26(31)18-12-6-2-7-13-18)21(29)20(34-24)16-33-25(30)17-10-4-1-5-11-17/h1-15,20-24H,16H2/t20-,21-,22+,23-,24?/m1/s1 |
| InChIKey | DQGKOZVDPPWLFZ-MLYSRARTSA-N |
| XLogP | 4.75 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|