C13H14BrFO3 — CID 139571779
[(2S,3R,4S,5R)-5-bromo-4-fluoro-3-methyloxolan-2-yl]methyl benzoate (PubChem CID 139571779) has the molecular formula C13H14BrFO3 and a molecular weight of 317.15 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-5-bromo-4-fluoro-3-methyloxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4S,5R)-5-bromo-4-fluoro-3-methyloxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 139571779 |
| Molecular Formula | C13H14BrFO3 |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | [(2S,3R,4S,5R)-5-bromo-4-fluoro-3-methyloxolan-2-yl]methyl benzoate |
| SMILES | C[C@H]1[C@H](F)[C@@H](Br)O[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H14BrFO3/c1-8-10(18-12(14)11(8)15)7-17-13(16)9-5-3-2-4-6-9/h2-6,8,10-12H,7H2,1H3/t8-,10-,11+,12+/m1/s1 |
| InChIKey | TUPKQAVWPGUEMG-YJQGPUDQSA-N |
| XLogP | 2.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|