C13H14BrFO3 — CID 89374199
[(2R,3R,5S)-5-bromo-2-ethyl-4-fluorooxolan-3-yl] benzoate (PubChem CID 89374199) has the molecular formula C13H14BrFO3 and a molecular weight of 317.15 g/mol. Its IUPAC name is [(2R,3R,5S)-5-bromo-2-ethyl-4-fluorooxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,5S)-5-bromo-2-ethyl-4-fluorooxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 89374199 |
| Molecular Formula | C13H14BrFO3 |
| Molecular Weight | 317.15 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | [(2R,3R,5S)-5-bromo-2-ethyl-4-fluorooxolan-3-yl] benzoate |
| SMILES | CC[C@H]1O[C@@H](Br)C(F)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H14BrFO3/c1-2-9-11(10(15)12(14)17-9)18-13(16)8-6-4-3-5-7-8/h3-7,9-12H,2H2,1H3/t9-,10?,11-,12-/m1/s1 |
| InChIKey | CUZDBQSAHJCUDM-DBPBRPCRSA-N |
| XLogP | 3.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|