C20H19FO5 — CID 58741926
[(2S,3S,4R,5S)-5-benzoyloxy-2-ethyl-4-fluorooxolan-3-yl] benzoate (PubChem CID 58741926) has the molecular formula C20H19FO5 and a molecular weight of 358.37 g/mol. Its IUPAC name is [(2S,3S,4R,5S)-5-benzoyloxy-2-ethyl-4-fluorooxolan-3-yl] benzoate.
| Compound Name | [(2S,3S,4R,5S)-5-benzoyloxy-2-ethyl-4-fluorooxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 58741926 |
| Molecular Formula | C20H19FO5 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [(2S,3S,4R,5S)-5-benzoyloxy-2-ethyl-4-fluorooxolan-3-yl] benzoate |
| SMILES | CC[C@@H]1O[C@@H](OC(=O)c2ccccc2)[C@H](F)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19FO5/c1-2-15-17(25-18(22)13-9-5-3-6-10-13)16(21)20(24-15)26-19(23)14-11-7-4-8-12-14/h3-12,15-17,20H,2H2,1H3/t15-,16+,17-,20-/m0/s1 |
| InChIKey | ZKZCPVGEBCIFMQ-CLWJZODNSA-N |
| XLogP | 3.54 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |