C21H19F3O8S — CID 88548426
[(2R,4S,5R)-5-benzoyloxy-2-ethyl-4-(trifluoromethylsulfonyloxy)oxolan-3-yl] benzoate (PubChem CID 88548426) has the molecular formula C21H19F3O8S and a molecular weight of 488.44 g/mol. Its IUPAC name is [(2R,4S,5R)-5-benzoyloxy-2-ethyl-4-(trifluoromethylsulfonyloxy)oxolan-3-yl] benzoate.
| Compound Name | [(2R,4S,5R)-5-benzoyloxy-2-ethyl-4-(trifluoromethylsulfonyloxy)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 88548426 |
| Molecular Formula | C21H19F3O8S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | [(2R,4S,5R)-5-benzoyloxy-2-ethyl-4-(trifluoromethylsulfonyloxy)oxolan-3-yl] benzoate |
| SMILES | CC[C@H]1O[C@H](OC(=O)c2ccccc2)[C@@H](OS(=O)(=O)C(F)(F)F)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H19F3O8S/c1-2-15-16(30-18(25)13-9-5-3-6-10-13)17(32-33(27,28)21(22,23)24)20(29-15)31-19(26)14-11-7-4-8-12-14/h3-12,15-17,20H,2H2,1H3/t15-,16?,17+,20-/m1/s1 |
| InChIKey | HXICJZNYEHSEOC-MQWDNKACSA-N |
| XLogP | 3.44 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|