C23H26O5 — CID 121355233
[(2S,4S,5S)-2-benzoyloxy-6-ethyl-4,5-dimethyloxan-3-yl] benzoate (PubChem CID 121355233) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is [(2S,4S,5S)-2-benzoyloxy-6-ethyl-4,5-dimethyloxan-3-yl] benzoate.
| Compound Name | [(2S,4S,5S)-2-benzoyloxy-6-ethyl-4,5-dimethyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 121355233 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [(2S,4S,5S)-2-benzoyloxy-6-ethyl-4,5-dimethyloxan-3-yl] benzoate |
| SMILES | CCC1O[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C23H26O5/c1-4-19-15(2)16(3)20(27-21(24)17-11-7-5-8-12-17)23(26-19)28-22(25)18-13-9-6-10-14-18/h5-16,19-20,23H,4H2,1-3H3/t15-,16-,19?,20?,23-/m0/s1 |
| InChIKey | UEFMFOLFNDPNNI-NFYDDXRESA-N |
| XLogP | 4.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |