C28H36O6 — CID 160919622
[(2S,4S,5S)-6-ethyl-4,5-dimethyl-2-(5-oxo-5-phenylmethoxypentoxy)oxan-3-yl] benzoate (PubChem CID 160919622) has the molecular formula C28H36O6 and a molecular weight of 468.59 g/mol. Its IUPAC name is [(2S,4S,5S)-6-ethyl-4,5-dimethyl-2-(5-oxo-5-phenylmethoxypentoxy)oxan-3-yl] benzoate.
| Compound Name | [(2S,4S,5S)-6-ethyl-4,5-dimethyl-2-(5-oxo-5-phenylmethoxypentoxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 160919622 |
| Molecular Formula | C28H36O6 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [(2S,4S,5S)-6-ethyl-4,5-dimethyl-2-(5-oxo-5-phenylmethoxypentoxy)oxan-3-yl] benzoate |
| SMILES | CCC1O[C@H](OCCCCC(=O)OCc2ccccc2)C(OC(=O)c2ccccc2)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C28H36O6/c1-4-24-20(2)21(3)26(34-27(30)23-15-9-6-10-16-23)28(33-24)31-18-12-11-17-25(29)32-19-22-13-7-5-8-14-22/h5-10,13-16,20-21,24,26,28H,4,11-12,17-19H2,1-3H3/t20-,21-,24?,26?,28-/m0/s1 |
| InChIKey | GOFCNDQOLIKZPZ-YAZUOJKMSA-N |
| XLogP | 5.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|