C44H48O10 — CID 59345765
[2-[(4-benzoyloxy-5-pent-4-enoxy-3-phenylmethoxyoxolan-2-yl)methoxy]-5-ethyl-4-phenylmethoxyoxolan-3-yl] benzoate (PubChem CID 59345765) has the molecular formula C44H48O10 and a molecular weight of 736.86 g/mol. Its IUPAC name is [2-[(4-benzoyloxy-5-pent-4-enoxy-3-phenylmethoxyoxolan-2-yl)methoxy]-5-ethyl-4-phenylmethoxyoxolan-3-yl] benzoate.
| Compound Name | [2-[(4-benzoyloxy-5-pent-4-enoxy-3-phenylmethoxyoxolan-2-yl)methoxy]-5-ethyl-4-phenylmethoxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 59345765 |
| Molecular Formula | C44H48O10 |
| Molecular Weight | 736.86 g/mol |
| Exact Mass | 736.32 |
| IUPAC Name | [2-[(4-benzoyloxy-5-pent-4-enoxy-3-phenylmethoxyoxolan-2-yl)methoxy]-5-ethyl-4-phenylmethoxyoxolan-3-yl] benzoate |
| SMILES | C=CCCCOC1OC(COC2OC(CC)C(OCc3ccccc3)C2OC(=O)c2ccccc2)C(OCc2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C44H48O10/c1-3-5-18-27-47-43-40(54-42(46)34-25-16-9-17-26-34)38(49-29-32-21-12-7-13-22-32)36(52-43)30-50-44-39(53-41(45)33-23-14-8-15-24-33)37(35(4-2)51-44)48-28-31-19-10-6-11-20-31/h3,6-17,19-26,35-40,43-44H,1,4-5,18,27-30H2,2H3 |
| InChIKey | ZKQJYUUPRBECRX-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.86 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|