C62H60O14 — CID 135033257
[(3R,6S)-4,5-dibenzoyloxy-6-methoxy-2-[[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] benzoate (PubChem CID 135033257) has the molecular formula C62H60O14 and a molecular weight of 1029.15 g/mol. Its IUPAC name is [(3R,6S)-4,5-dibenzoyloxy-6-methoxy-2-[[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] benzoate.
| Compound Name | [(3R,6S)-4,5-dibenzoyloxy-6-methoxy-2-[[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 135033257 |
| Molecular Formula | C62H60O14 |
| Molecular Weight | 1029.15 g/mol |
| Exact Mass | 1028.40 |
| IUPAC Name | [(3R,6S)-4,5-dibenzoyloxy-6-methoxy-2-[[(2S,5R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]oxan-3-yl] benzoate |
| SMILES | CO[C@H]1OC(CO[C@H]2OC(COCc3ccccc3)[C@@H](OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)[C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C62H60O14/c1-66-61-57(76-60(65)49-35-21-8-22-36-49)55(75-59(64)48-33-19-7-20-34-48)53(74-58(63)47-31-17-6-18-32-47)51(72-61)42-71-62-56(70-40-46-29-15-5-16-30-46)54(69-39-45-27-13-4-14-28-45)52(68-38-44-25-11-3-12-26-44)50(73-62)41-67-37-43-23-9-2-10-24-43/h2-36,50-57,61-62H,37-42H2,1H3/t50?,51?,52-,53-,54?,55?,56?,57?,61+,62+/m1/s1 |
| InChIKey | RGZPHINDFHDVMO-XAXDAZNUSA-N |
| XLogP | 9.75 |
| TPSA | 152.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.15 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|