C62H58O15 — CID 101204775
[(2R,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxan-2-yl]methyl benzoate (PubChem CID 101204775) has the molecular formula C62H58O15 and a molecular weight of 1043.13 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101204775 |
| Molecular Formula | C62H58O15 |
| Molecular Weight | 1043.13 g/mol |
| Exact Mass | 1042.38 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tribenzoyloxy-6-[[(2R,3R,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methoxy]oxan-2-yl]methyl benzoate |
| SMILES | CO[C@H]1O[C@H](CO[C@@H]2O[C@H](COC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C62H58O15/c1-67-61-55(70-39-44-27-13-4-14-28-44)53(69-38-43-25-11-3-12-26-43)51(68-37-42-23-9-2-10-24-42)49(73-61)41-72-62-56(77-60(66)48-35-21-8-22-36-48)54(76-59(65)47-33-19-7-20-34-47)52(75-58(64)46-31-17-6-18-32-46)50(74-62)40-71-57(63)45-29-15-5-16-30-45/h2-36,49-56,61-62H,37-41H2,1H3/t49-,50-,51-,52+,53+,54+,55-,56-,61+,62-/m1/s1 |
| InChIKey | KGGQKUPKURALRO-YFIKZCEYSA-N |
| XLogP | 9.39 |
| TPSA | 169.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1043.13 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|