C28H30O7 — CID 25265643
[(3R,4S,5S)-6-(hydroxymethyl)-2-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate (PubChem CID 25265643) has the molecular formula C28H30O7 and a molecular weight of 478.54 g/mol. Its IUPAC name is [(3R,4S,5S)-6-(hydroxymethyl)-2-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate.
| Compound Name | [(3R,4S,5S)-6-(hydroxymethyl)-2-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 25265643 |
| Molecular Formula | C28H30O7 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [(3R,4S,5S)-6-(hydroxymethyl)-2-methoxy-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
| SMILES | COC1OC(CO)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H30O7/c1-31-28-26(35-27(30)22-15-9-4-10-16-22)25(33-19-21-13-7-3-8-14-21)24(23(17-29)34-28)32-18-20-11-5-2-6-12-20/h2-16,23-26,28-29H,17-19H2,1H3/t23?,24-,25-,26+,28?/m0/s1 |
| InChIKey | UAYGLVUYMCGHAV-ICANIPJQSA-N |
| XLogP | 3.75 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |