C22H24O8 — CID 122425622
[(3R,4S,6R)-5-benzoyloxy-2-(hydroxymethyl)-3,6-dimethoxyoxan-4-yl] benzoate (PubChem CID 122425622) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is [(3R,4S,6R)-5-benzoyloxy-2-(hydroxymethyl)-3,6-dimethoxyoxan-4-yl] benzoate.
| Compound Name | [(3R,4S,6R)-5-benzoyloxy-2-(hydroxymethyl)-3,6-dimethoxyoxan-4-yl] benzoate |
|---|---|
| PubChem CID | 122425622 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | [(3R,4S,6R)-5-benzoyloxy-2-(hydroxymethyl)-3,6-dimethoxyoxan-4-yl] benzoate |
| SMILES | CO[C@@H]1OC(CO)[C@@H](OC)[C@H](OC(=O)c2ccccc2)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24O8/c1-26-17-16(13-23)28-22(27-2)19(30-21(25)15-11-7-4-8-12-15)18(17)29-20(24)14-9-5-3-6-10-14/h3-12,16-19,22-23H,13H2,1-2H3/t16?,17-,18+,19?,22-/m1/s1 |
| InChIKey | DUWDYLIVYNDGRY-IKOGLXSISA-N |
| XLogP | 1.82 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |