C22H26O11 — CID 6613806
[(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(prop-2-enoxycarbonyloxy)oxan-3-yl] benzoate (PubChem CID 6613806) has the molecular formula C22H26O11 and a molecular weight of 466.44 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(prop-2-enoxycarbonyloxy)oxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(prop-2-enoxycarbonyloxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 6613806 |
| Molecular Formula | C22H26O11 |
| Molecular Weight | 466.44 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(prop-2-enoxycarbonyloxy)oxan-3-yl] benzoate |
| SMILES | C=CCOC(=O)O[C@@H]1[C@H](OC(=O)OCC=C)[C@@H](OC)O[C@H](CO)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26O11/c1-4-11-28-21(25)32-17-16(31-19(24)14-9-7-6-8-10-14)15(13-23)30-20(27-3)18(17)33-22(26)29-12-5-2/h4-10,15-18,20,23H,1-2,11-13H2,3H3/t15-,16-,17+,18+,20+/m1/s1 |
| InChIKey | DBDYGLQUQCBGCT-JGLNRKDHSA-N |
| XLogP | 1.99 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|