C26H34O9 — CID 6613742
[(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis[[(2S)-2-methylpent-4-enoyl]oxy]oxan-3-yl] benzoate (PubChem CID 6613742) has the molecular formula C26H34O9 and a molecular weight of 490.55 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis[[(2S)-2-methylpent-4-enoyl]oxy]oxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis[[(2S)-2-methylpent-4-enoyl]oxy]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 6613742 |
| Molecular Formula | C26H34O9 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis[[(2S)-2-methylpent-4-enoyl]oxy]oxan-3-yl] benzoate |
| SMILES | C=CC[C@H](C)C(=O)O[C@@H]1[C@@H](OC(=O)[C@@H](C)CC=C)[C@@H](OC)O[C@H](CO)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H34O9/c1-6-11-16(3)23(28)34-21-20(33-25(30)18-13-9-8-10-14-18)19(15-27)32-26(31-5)22(21)35-24(29)17(4)12-7-2/h6-10,13-14,16-17,19-22,26-27H,1-2,11-12,15H2,3-5H3/t16-,17-,19+,20+,21-,22+,26-/m0/s1 |
| InChIKey | DSVZNMNMXRPYFR-KMGNMMDSSA-N |
| XLogP | 2.82 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|