C25H33NO9 — CID 6613680
[(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-methoxy-4-pent-4-enoyloxy-5-(phenylcarbamoyloxy)oxan-3-yl] (2S)-2-methylpent-4-enoate (PubChem CID 6613680) has the molecular formula C25H33NO9 and a molecular weight of 491.54 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-methoxy-4-pent-4-enoyloxy-5-(phenylcarbamoyloxy)oxan-3-yl] (2S)-2-methylpent-4-enoate.
| Compound Name | [(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-methoxy-4-pent-4-enoyloxy-5-(phenylcarbamoyloxy)oxan-3-yl] (2S)-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 6613680 |
| Molecular Formula | C25H33NO9 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-6-(hydroxymethyl)-2-methoxy-4-pent-4-enoyloxy-5-(phenylcarbamoyloxy)oxan-3-yl] (2S)-2-methylpent-4-enoate |
| SMILES | C=CCCC(=O)O[C@@H]1[C@@H](OC(=O)[C@@H](C)CC=C)[C@@H](OC)O[C@H](CO)[C@H]1OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H33NO9/c1-5-7-14-19(28)33-21-20(35-25(30)26-17-12-9-8-10-13-17)18(15-27)32-24(31-4)22(21)34-23(29)16(3)11-6-2/h5-6,8-10,12-13,16,18,20-22,24,27H,1-2,7,11,14-15H2,3-4H3,(H,26,30)/t16-,18+,20+,21-,22+,24-/m0/s1 |
| InChIKey | AESPZLYORNQNHF-DYMFUQPJSA-N |
| XLogP | 2.97 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|