C24H31NO9 — CID 6613546
[(1S,4R,9R,12S,13R,15S,16R)-13-(hydroxymethyl)-15-methoxy-4,9-dimethyl-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] N-phenylcarbamate (PubChem CID 6613546) has the molecular formula C24H31NO9 and a molecular weight of 477.51 g/mol. Its IUPAC name is [(1S,4R,9R,12S,13R,15S,16R)-13-(hydroxymethyl)-15-methoxy-4,9-dimethyl-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] N-phenylcarbamate.
| Compound Name | [(1S,4R,9R,12S,13R,15S,16R)-13-(hydroxymethyl)-15-methoxy-4,9-dimethyl-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 6613546 |
| Molecular Formula | C24H31NO9 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | [(1S,4R,9R,12S,13R,15S,16R)-13-(hydroxymethyl)-15-methoxy-4,9-dimethyl-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] N-phenylcarbamate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H]2OC(=O)[C@H](C)CC=CC[C@@H](C)C(=O)O[C@@H]2[C@H]1OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C24H31NO9/c1-14-9-7-8-10-15(2)22(28)33-19-18(32-21(14)27)17(13-26)31-23(30-3)20(19)34-24(29)25-16-11-5-4-6-12-16/h4-8,11-12,14-15,17-20,23,26H,9-10,13H2,1-3H3,(H,25,29)/t14-,15-,17-,18+,19+,20-,23+/m1/s1 |
| InChIKey | YDXGICWEVADDQU-UPRPRMGVSA-N |
| XLogP | 2.41 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|