C29H28N4O9 — CID 23975553
[(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(phenylcarbamoyloxy)oxan-3-yl] N-(4-cyanophenyl)carbamate (PubChem CID 23975553) has the molecular formula C29H28N4O9 and a molecular weight of 576.56 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(phenylcarbamoyloxy)oxan-3-yl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(phenylcarbamoyloxy)oxan-3-yl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23975553 |
| Molecular Formula | C29H28N4O9 |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.19 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-4,5-bis(phenylcarbamoyloxy)oxan-3-yl] N-(4-cyanophenyl)carbamate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](OC(=O)Nc2ccc(C#N)cc2)[C@H](OC(=O)Nc2ccccc2)[C@@H]1OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C29H28N4O9/c1-38-26-25(42-29(37)32-20-10-6-3-7-11-20)24(41-28(36)31-19-8-4-2-5-9-19)23(22(17-34)39-26)40-27(35)33-21-14-12-18(16-30)13-15-21/h2-15,22-26,34H,17H2,1H3,(H,31,36)(H,32,37)(H,33,35)/t22-,23-,24+,25+,26+/m1/s1 |
| InChIKey | VMYOFJANGWKQBL-JMTTVTNBSA-N |
| XLogP | 4.07 |
| TPSA | 177.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|