C34H33N3O9 — CID 24868648
[(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-5-(phenylcarbamoyloxy)-3-[(2-phenylphenyl)carbamoyloxy]oxan-4-yl] N-phenylcarbamate (PubChem CID 24868648) has the molecular formula C34H33N3O9 and a molecular weight of 627.65 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-5-(phenylcarbamoyloxy)-3-[(2-phenylphenyl)carbamoyloxy]oxan-4-yl] N-phenylcarbamate.
| Compound Name | [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-5-(phenylcarbamoyloxy)-3-[(2-phenylphenyl)carbamoyloxy]oxan-4-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 24868648 |
| Molecular Formula | C34H33N3O9 |
| Molecular Weight | 627.65 g/mol |
| Exact Mass | 627.22 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-2-(hydroxymethyl)-6-methoxy-5-(phenylcarbamoyloxy)-3-[(2-phenylphenyl)carbamoyloxy]oxan-4-yl] N-phenylcarbamate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](OC(=O)Nc2ccccc2-c2ccccc2)[C@H](OC(=O)Nc2ccccc2)[C@@H]1OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C34H33N3O9/c1-42-31-30(46-33(40)36-24-17-9-4-10-18-24)29(45-32(39)35-23-15-7-3-8-16-23)28(27(21-38)43-31)44-34(41)37-26-20-12-11-19-25(26)22-13-5-2-6-14-22/h2-20,27-31,38H,21H2,1H3,(H,35,39)(H,36,40)(H,37,41)/t27-,28-,29+,30+,31+/m1/s1 |
| InChIKey | INADHJKKGXCSHN-YOGXEWEVSA-N |
| XLogP | 5.87 |
| TPSA | 153.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|