C38H43NO10 — CID 23899970
[(1S,4R,6E,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] N-(2-methoxy-6-methylphenyl)carbamate (PubChem CID 23899970) has the molecular formula C38H43NO10 and a molecular weight of 673.76 g/mol. Its IUPAC name is [(1S,4R,6E,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] N-(2-methoxy-6-methylphenyl)carbamate.
| Compound Name | [(1S,4R,6E,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] N-(2-methoxy-6-methylphenyl)carbamate |
|---|---|
| PubChem CID | 23899970 |
| Molecular Formula | C38H43NO10 |
| Molecular Weight | 673.76 g/mol |
| Exact Mass | 673.29 |
| IUPAC Name | [(1S,4R,6E,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] N-(2-methoxy-6-methylphenyl)carbamate |
| SMILES | COc1cccc(C)c1NC(=O)O[C@H]1[C@@H]2OC(=O)[C@@H](Cc3ccccc3)C/C=C/C[C@H](Cc3ccccc3)C(=O)O[C@H]2[C@@H](OC)O[C@@H]1CO |
| InChI | InChI=1S/C38H43NO10/c1-24-13-12-20-29(44-2)31(24)39-38(43)49-32-30(23-40)46-37(45-3)34-33(32)47-35(41)27(21-25-14-6-4-7-15-25)18-10-11-19-28(36(42)48-34)22-26-16-8-5-9-17-26/h4-17,20,27-28,30,32-34,37,40H,18-19,21-23H2,1-3H3,(H,39,43)/b11-10+/t27-,28-,30-,32-,33+,34-,37+/m1/s1 |
| InChIKey | XDOOBIZEQYTHKN-SJBPWELVSA-N |
| XLogP | 5.18 |
| TPSA | 138.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.76 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|