C36H37BrO9 — CID 24868645
[(1S,4R,6Z,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] 4-bromobenzoate (PubChem CID 24868645) has the molecular formula C36H37BrO9 and a molecular weight of 693.59 g/mol. Its IUPAC name is [(1S,4R,6Z,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] 4-bromobenzoate.
| Compound Name | [(1S,4R,6Z,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 24868645 |
| Molecular Formula | C36H37BrO9 |
| Molecular Weight | 693.59 g/mol |
| Exact Mass | 692.16 |
| IUPAC Name | [(1S,4R,6Z,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] 4-bromobenzoate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](OC(=O)c2ccc(Br)cc2)[C@@H]2OC(=O)[C@@H](Cc3ccccc3)C/C=C\C[C@H](Cc3ccccc3)C(=O)O[C@@H]12 |
| InChI | InChI=1S/C36H37BrO9/c1-42-36-32-31(30(29(22-38)43-36)44-33(39)25-16-18-28(37)19-17-25)45-34(40)26(20-23-10-4-2-5-11-23)14-8-9-15-27(35(41)46-32)21-24-12-6-3-7-13-24/h2-13,16-19,26-27,29-32,36,38H,14-15,20-22H2,1H3/b9-8-/t26-,27-,29-,30-,31+,32-,36+/m1/s1 |
| InChIKey | WUZZYENXETVQKW-NGERWCRMSA-N |
| XLogP | 5.23 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.59 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|