C22H26O9 — CID 6613638
[(1S,12R,13R,15S,16R)-13-(hydroxymethyl)-15-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] benzoate (PubChem CID 6613638) has the molecular formula C22H26O9 and a molecular weight of 434.44 g/mol. Its IUPAC name is [(1S,12R,13R,15S,16R)-13-(hydroxymethyl)-15-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] benzoate.
| Compound Name | [(1S,12R,13R,15S,16R)-13-(hydroxymethyl)-15-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] benzoate |
|---|---|
| PubChem CID | 6613638 |
| Molecular Formula | C22H26O9 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [(1S,12R,13R,15S,16R)-13-(hydroxymethyl)-15-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] benzoate |
| SMILES | CO[C@H]1O[C@H](CO)[C@H]2OC(=O)CCC=CCCC(=O)O[C@@H]2[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26O9/c1-27-22-20(31-21(26)14-9-5-4-6-10-14)19-18(15(13-23)28-22)29-16(24)11-7-2-3-8-12-17(25)30-19/h2-6,9-10,15,18-20,22-23H,7-8,11-13H2,1H3/t15-,18-,19+,20-,22+/m1/s1 |
| InChIKey | ZMLRAYREONRERO-PGPONNFDSA-N |
| XLogP | 1.53 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|