C36H38FNO9 — CID 44634692
[(1S,4R,6E,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] N-(3-fluorophenyl)carbamate (PubChem CID 44634692) has the molecular formula C36H38FNO9 and a molecular weight of 647.70 g/mol. Its IUPAC name is [(1S,4R,6E,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] N-(3-fluorophenyl)carbamate.
| Compound Name | [(1S,4R,6E,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] N-(3-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 44634692 |
| Molecular Formula | C36H38FNO9 |
| Molecular Weight | 647.70 g/mol |
| Exact Mass | 647.25 |
| IUPAC Name | [(1S,4R,6E,9R,12R,13S,15R,16R)-4,9-dibenzyl-15-(hydroxymethyl)-13-methoxy-3,10-dioxo-2,11,14-trioxabicyclo[10.4.0]hexadec-6-en-16-yl] N-(3-fluorophenyl)carbamate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](OC(=O)Nc2cccc(F)c2)[C@@H]2OC(=O)[C@@H](Cc3ccccc3)C/C=C/C[C@H](Cc3ccccc3)C(=O)O[C@@H]12 |
| InChI | InChI=1S/C36H38FNO9/c1-43-35-32-31(30(29(22-39)44-35)47-36(42)38-28-18-10-17-27(37)21-28)45-33(40)25(19-23-11-4-2-5-12-23)15-8-9-16-26(34(41)46-32)20-24-13-6-3-7-14-24/h2-14,17-18,21,25-26,29-32,35,39H,15-16,19-20,22H2,1H3,(H,38,42)/b9-8+/t25-,26-,29-,30-,31+,32-,35+/m1/s1 |
| InChIKey | KBUAJHCEQJZYTH-JGNZDMPISA-N |
| XLogP | 5.00 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|