C40H40N2O11 — CID 6613811
[(2S,3R,4S,5R,6R)-4,5-bis[[(2R)-2-(1,3-benzoxazol-2-ylmethyl)pent-4-enoyl]oxy]-6-(hydroxymethyl)-2-methoxyoxan-3-yl] benzoate (PubChem CID 6613811) has the molecular formula C40H40N2O11 and a molecular weight of 724.76 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-4,5-bis[[(2R)-2-(1,3-benzoxazol-2-ylmethyl)pent-4-enoyl]oxy]-6-(hydroxymethyl)-2-methoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4S,5R,6R)-4,5-bis[[(2R)-2-(1,3-benzoxazol-2-ylmethyl)pent-4-enoyl]oxy]-6-(hydroxymethyl)-2-methoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 6613811 |
| Molecular Formula | C40H40N2O11 |
| Molecular Weight | 724.76 g/mol |
| Exact Mass | 724.26 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-4,5-bis[[(2R)-2-(1,3-benzoxazol-2-ylmethyl)pent-4-enoyl]oxy]-6-(hydroxymethyl)-2-methoxyoxan-3-yl] benzoate |
| SMILES | C=CC[C@H](Cc1nc2ccccc2o1)C(=O)O[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@@H](OC)O[C@H](CO)[C@H]1OC(=O)[C@H](CC=C)Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C40H40N2O11/c1-4-13-25(21-32-41-27-17-9-11-19-29(27)48-32)38(45)51-34-31(23-43)50-40(47-3)36(53-37(44)24-15-7-6-8-16-24)35(34)52-39(46)26(14-5-2)22-33-42-28-18-10-12-20-30(28)49-33/h4-12,15-20,25-26,31,34-36,40,43H,1-2,13-14,21-23H2,3H3/t25-,26-,31-,34-,35+,36-,40+/m1/s1 |
| InChIKey | AVUBCYJAQZZATQ-BMKGFOPASA-N |
| XLogP | 5.55 |
| TPSA | 169.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.76 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|