C27H31O13P — CID 6613764
[(2R,3R,4R,5R,6S)-3-diphenoxyphosphoryloxy-2-(hydroxymethyl)-6-methoxy-5-prop-2-enoxycarbonyloxyoxan-4-yl] prop-2-enyl carbonate (PubChem CID 6613764) has the molecular formula C27H31O13P and a molecular weight of 594.51 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3-diphenoxyphosphoryloxy-2-(hydroxymethyl)-6-methoxy-5-prop-2-enoxycarbonyloxyoxan-4-yl] prop-2-enyl carbonate.
| Compound Name | [(2R,3R,4R,5R,6S)-3-diphenoxyphosphoryloxy-2-(hydroxymethyl)-6-methoxy-5-prop-2-enoxycarbonyloxyoxan-4-yl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 6613764 |
| Molecular Formula | C27H31O13P |
| Molecular Weight | 594.51 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3-diphenoxyphosphoryloxy-2-(hydroxymethyl)-6-methoxy-5-prop-2-enoxycarbonyloxyoxan-4-yl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)O[C@@H]1[C@@H](OC(=O)OCC=C)[C@@H](OC)O[C@H](CO)[C@H]1OP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C27H31O13P/c1-4-16-33-26(29)36-23-22(21(18-28)35-25(32-3)24(23)37-27(30)34-17-5-2)40-41(31,38-19-12-8-6-9-13-19)39-20-14-10-7-11-15-20/h4-15,21-25,28H,1-2,16-18H2,3H3/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | FZEJOMQSBGFSHE-RXFVIIJJSA-N |
| XLogP | 4.42 |
| TPSA | 154.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|