C18H22O9 — CID 20688925
[(2R,3R,4S,5S)-4,5-diacetyloxy-2-(hydroxymethyl)-6-phenoxyoxan-3-yl] acetate (PubChem CID 20688925) has the molecular formula C18H22O9 and a molecular weight of 382.37 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-4,5-diacetyloxy-2-(hydroxymethyl)-6-phenoxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S)-4,5-diacetyloxy-2-(hydroxymethyl)-6-phenoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 20688925 |
| Molecular Formula | C18H22O9 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | [(2R,3R,4S,5S)-4,5-diacetyloxy-2-(hydroxymethyl)-6-phenoxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](CO)OC(Oc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H22O9/c1-10(20)23-15-14(9-19)27-18(26-13-7-5-4-6-8-13)17(25-12(3)22)16(15)24-11(2)21/h4-8,14-19H,9H2,1-3H3/t14-,15-,16+,17+,18?/m1/s1 |
| InChIKey | ZWTDJFRCKBKITF-LPNAZMDGSA-N |
| XLogP | 0.58 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|