C28H30O6 — CID 10434489
[(2S,3R,4R,5S,6S)-6-methoxy-2-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate (PubChem CID 10434489) has the molecular formula C28H30O6 and a molecular weight of 462.54 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6S)-6-methoxy-2-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate.
| Compound Name | [(2S,3R,4R,5S,6S)-6-methoxy-2-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 10434489 |
| Molecular Formula | C28H30O6 |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | [(2S,3R,4R,5S,6S)-6-methoxy-2-methyl-4,5-bis(phenylmethoxy)oxan-3-yl] benzoate |
| SMILES | CO[C@H]1O[C@@H](C)[C@@H](OC(=O)c2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H30O6/c1-20-24(34-27(29)23-16-10-5-11-17-23)25(31-18-21-12-6-3-7-13-21)26(28(30-2)33-20)32-19-22-14-8-4-9-15-22/h3-17,20,24-26,28H,18-19H2,1-2H3/t20-,24+,25+,26-,28-/m0/s1 |
| InChIKey | QHPYLWCVOPASKX-YIHYQKFXSA-N |
| XLogP | 4.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |