C27H27NO6 — CID 102449200
[(2S,3S,4S,5S,6S)-5-amino-4-benzoyloxy-2-methyl-6-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 102449200) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6S)-5-amino-4-benzoyloxy-2-methyl-6-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4S,5S,6S)-5-amino-4-benzoyloxy-2-methyl-6-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 102449200 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | [(2S,3S,4S,5S,6S)-5-amino-4-benzoyloxy-2-methyl-6-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | C[C@@H]1O[C@H](OCc2ccccc2)[C@@H](N)[C@H](OC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H27NO6/c1-18-23(33-25(29)20-13-7-3-8-14-20)24(34-26(30)21-15-9-4-10-16-21)22(28)27(32-18)31-17-19-11-5-2-6-12-19/h2-16,18,22-24,27H,17,28H2,1H3/t18-,22-,23-,24-,27-/m0/s1 |
| InChIKey | SJBXESDKSGIRBS-QSFSQKMHSA-N |
| XLogP | 3.73 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |