C20H22O5 — CID 14768720
[(2R,3R,4R)-6-hydroxy-2-methyl-4-phenylmethoxyoxan-3-yl] benzoate (PubChem CID 14768720) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is [(2R,3R,4R)-6-hydroxy-2-methyl-4-phenylmethoxyoxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R)-6-hydroxy-2-methyl-4-phenylmethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 14768720 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | [(2R,3R,4R)-6-hydroxy-2-methyl-4-phenylmethoxyoxan-3-yl] benzoate |
| SMILES | C[C@H]1OC(O)C[C@@H](OCc2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H22O5/c1-14-19(25-20(22)16-10-6-3-7-11-16)17(12-18(21)24-14)23-13-15-8-4-2-5-9-15/h2-11,14,17-19,21H,12-13H2,1H3/t14-,17-,18?,19-/m1/s1 |
| InChIKey | NWVACPXWPIEZTK-VPBYMLOASA-N |
| XLogP | 2.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |