C20H20O6 — CID 10383621
[(2S,3R,4S,6S)-3-benzoyloxy-6-hydroxy-2-methyloxan-4-yl] benzoate (PubChem CID 10383621) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is [(2S,3R,4S,6S)-3-benzoyloxy-6-hydroxy-2-methyloxan-4-yl] benzoate.
| Compound Name | [(2S,3R,4S,6S)-3-benzoyloxy-6-hydroxy-2-methyloxan-4-yl] benzoate |
|---|---|
| PubChem CID | 10383621 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [(2S,3R,4S,6S)-3-benzoyloxy-6-hydroxy-2-methyloxan-4-yl] benzoate |
| SMILES | C[C@@H]1O[C@H](O)C[C@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20O6/c1-13-18(26-20(23)15-10-6-3-7-11-15)16(12-17(21)24-13)25-19(22)14-8-4-2-5-9-14/h2-11,13,16-18,21H,12H2,1H3/t13-,16-,17-,18+/m0/s1 |
| InChIKey | VNYPKNHJPZZNQO-XDKFSHSGSA-N |
| XLogP | 2.56 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |