C15H20O5 — CID 59065466
(5-hydroxy-4-methoxy-2,6-dimethyloxan-3-yl) benzoate (PubChem CID 59065466) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (5-hydroxy-4-methoxy-2,6-dimethyloxan-3-yl) benzoate.
| Compound Name | (5-hydroxy-4-methoxy-2,6-dimethyloxan-3-yl) benzoate |
|---|---|
| PubChem CID | 59065466 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (5-hydroxy-4-methoxy-2,6-dimethyloxan-3-yl) benzoate |
| SMILES | COC1C(O)C(C)OC(C)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20O5/c1-9-12(16)14(18-3)13(10(2)19-9)20-15(17)11-7-5-4-6-8-11/h4-10,12-14,16H,1-3H3 |
| InChIKey | LWAGEVIEOAOBJQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |