C35H30O10 — CID 14704229
[(1R,2R,3R,4S,5R,6S)-2,3,4-tribenzoyloxy-6-hydroxy-5-methoxycyclohexyl] benzoate (PubChem CID 14704229) has the molecular formula C35H30O10 and a molecular weight of 610.62 g/mol. Its IUPAC name is [(1R,2R,3R,4S,5R,6S)-2,3,4-tribenzoyloxy-6-hydroxy-5-methoxycyclohexyl] benzoate.
| Compound Name | [(1R,2R,3R,4S,5R,6S)-2,3,4-tribenzoyloxy-6-hydroxy-5-methoxycyclohexyl] benzoate |
|---|---|
| PubChem CID | 14704229 |
| Molecular Formula | C35H30O10 |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.18 |
| IUPAC Name | [(1R,2R,3R,4S,5R,6S)-2,3,4-tribenzoyloxy-6-hydroxy-5-methoxycyclohexyl] benzoate |
| SMILES | CO[C@H]1[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C35H30O10/c1-41-27-26(36)28(42-32(37)22-14-6-2-7-15-22)30(44-34(39)24-18-10-4-11-19-24)31(45-35(40)25-20-12-5-13-21-25)29(27)43-33(38)23-16-8-3-9-17-23/h2-21,26-31,36H,1H3/t26-,27+,28?,29-,30+,31+/m0/s1 |
| InChIKey | OVBISUZLBLLBRB-ABPRUMIKSA-N |
| XLogP | 4.28 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|