C27H24O9 — CID 10863923
[(1R,2S,3R,4S,5S,6S)-3,4-dibenzoyloxy-2,5,6-trihydroxycyclohexyl] benzoate (PubChem CID 10863923) has the molecular formula C27H24O9 and a molecular weight of 492.48 g/mol. Its IUPAC name is [(1R,2S,3R,4S,5S,6S)-3,4-dibenzoyloxy-2,5,6-trihydroxycyclohexyl] benzoate.
| Compound Name | [(1R,2S,3R,4S,5S,6S)-3,4-dibenzoyloxy-2,5,6-trihydroxycyclohexyl] benzoate |
|---|---|
| PubChem CID | 10863923 |
| Molecular Formula | C27H24O9 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | [(1R,2S,3R,4S,5S,6S)-3,4-dibenzoyloxy-2,5,6-trihydroxycyclohexyl] benzoate |
| SMILES | O=C(O[C@@H]1[C@@H](O)[C@H](OC(=O)c2ccccc2)[C@@H](O)C(O)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H24O9/c28-19-20(29)23(35-26(32)17-12-6-2-7-13-17)24(36-27(33)18-14-8-3-9-15-18)21(30)22(19)34-25(31)16-10-4-1-5-11-16/h1-15,19-24,28-30H/t19-,20?,21-,22+,23-,24+/m0/s1 |
| InChIKey | VCMNAXSEEQVJPM-HJQBPIIMSA-N |
| XLogP | 1.76 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|