C27H28O7 — CID 10863559
[(2S,3S,5S,6R)-3,4,5-trihydroxy-2,6-bis(phenylmethoxy)cyclohexyl] benzoate (PubChem CID 10863559) has the molecular formula C27H28O7 and a molecular weight of 464.51 g/mol. Its IUPAC name is [(2S,3S,5S,6R)-3,4,5-trihydroxy-2,6-bis(phenylmethoxy)cyclohexyl] benzoate.
| Compound Name | [(2S,3S,5S,6R)-3,4,5-trihydroxy-2,6-bis(phenylmethoxy)cyclohexyl] benzoate |
|---|---|
| PubChem CID | 10863559 |
| Molecular Formula | C27H28O7 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | [(2S,3S,5S,6R)-3,4,5-trihydroxy-2,6-bis(phenylmethoxy)cyclohexyl] benzoate |
| SMILES | O=C(OC1[C@H](OCc2ccccc2)C(O)C(O)[C@H](O)[C@@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28O7/c28-21-22(29)24(32-16-18-10-4-1-5-11-18)26(34-27(31)20-14-8-3-9-15-20)25(23(21)30)33-17-19-12-6-2-7-13-19/h1-15,21-26,28-30H,16-17H2/t21?,22-,23?,24-,25+,26?/m0/s1 |
| InChIKey | FFNZJYAUDYBUFI-UJQAUIMPSA-N |
| XLogP | 2.48 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |