C20H20O8 — CID 10862027
[(1R,3S,4R,6S)-3-benzoyloxy-2,4,5,6-tetrahydroxycyclohexyl] benzoate (PubChem CID 10862027) has the molecular formula C20H20O8 and a molecular weight of 388.37 g/mol. Its IUPAC name is [(1R,3S,4R,6S)-3-benzoyloxy-2,4,5,6-tetrahydroxycyclohexyl] benzoate.
| Compound Name | [(1R,3S,4R,6S)-3-benzoyloxy-2,4,5,6-tetrahydroxycyclohexyl] benzoate |
|---|---|
| PubChem CID | 10862027 |
| Molecular Formula | C20H20O8 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [(1R,3S,4R,6S)-3-benzoyloxy-2,4,5,6-tetrahydroxycyclohexyl] benzoate |
| SMILES | O=C(O[C@@H]1C(O)[C@H](OC(=O)c2ccccc2)[C@@H](O)C(O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C20H20O8/c21-13-14(22)17(27-19(25)11-7-3-1-4-8-11)16(24)18(15(13)23)28-20(26)12-9-5-2-6-10-12/h1-10,13-18,21-24H/t13?,14-,15+,16?,17+,18- |
| InChIKey | FULZFGPWFILVPE-YZYVCRMGSA-N |
| XLogP | -0.11 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |