C26H20O6 — CID 12660047
(4,5-dibenzoyloxycyclopent-2-en-1-yl) benzoate (PubChem CID 12660047) has the molecular formula C26H20O6 and a molecular weight of 428.44 g/mol. Its IUPAC name is (4,5-dibenzoyloxycyclopent-2-en-1-yl) benzoate.
| Compound Name | (4,5-dibenzoyloxycyclopent-2-en-1-yl) benzoate |
|---|---|
| PubChem CID | 12660047 |
| Molecular Formula | C26H20O6 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (4,5-dibenzoyloxycyclopent-2-en-1-yl) benzoate |
| SMILES | O=C(OC1C=CC(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H20O6/c27-24(18-10-4-1-5-11-18)30-21-16-17-22(31-25(28)19-12-6-2-7-13-19)23(21)32-26(29)20-14-8-3-9-15-20/h1-17,21-23H |
| InChIKey | SRAWTHYPFFBVIL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|