About (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane
(4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane (PubChem CID 161382520) has the molecular formula C21H22O4
and a molecular weight of 338.40 g/mol. Its IUPAC name is (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane.
Molecular Properties
| Compound Name | (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane |
| PubChem CID | 161382520 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane |
| SMILES | C.O=C(OC1C=CC(OC(=O)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H18O4.CH4/c21-19(15-7-3-1-4-8-15)23-17-11-13-18(14-12-17)24-20(22)16-9-5-2-6-10-16;/h1-11,13,17-18H,12,14H2;1H4 |
| InChIKey | VRXDNUACKPCTBB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane?
The IUPAC name of (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane (CID 161382520) is (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane.
What is the SMILES notation for (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane?
The canonical SMILES for (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane is C.O=C(OC1C=CC(OC(=O)c2ccccc2)CC1)c1ccccc1.
What is the InChIKey of (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane?
The InChIKey is VRXDNUACKPCTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O4.CH4/c21-19(15-7-3-1-4-8-15)23-17-11-13-18(14-12-17)24-20(22)16-9-5-2-6-10-16;/h1-11,13,17-18H,12,14H2;1H4.
What are the key properties of (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane?
(4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane has a molecular weight of 338.40 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-benzoyloxycyclohex-2-en-1-yl) benzoate;methane is sourced from PubChem (CID 161382520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).