C24H33BO2 — CID 101214199
[(1R,4R)-4-[3-(9-borabicyclo[3.3.1]nonan-9-yl)propyl]cyclohex-2-en-1-yl] benzoate (PubChem CID 101214199) has the molecular formula C24H33BO2 and a molecular weight of 364.34 g/mol. Its IUPAC name is [(1R,4R)-4-[3-(9-borabicyclo[3.3.1]nonan-9-yl)propyl]cyclohex-2-en-1-yl] benzoate.
| Compound Name | [(1R,4R)-4-[3-(9-borabicyclo[3.3.1]nonan-9-yl)propyl]cyclohex-2-en-1-yl] benzoate |
|---|---|
| PubChem CID | 101214199 |
| Molecular Formula | C24H33BO2 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [(1R,4R)-4-[3-(9-borabicyclo[3.3.1]nonan-9-yl)propyl]cyclohex-2-en-1-yl] benzoate |
| SMILES | O=C(O[C@H]1C=C[C@H](CCCB2C3CCCC2CCC3)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H33BO2/c26-24(20-8-2-1-3-9-20)27-23-16-14-19(15-17-23)7-6-18-25-21-10-4-11-22(25)13-5-12-21/h1-3,8-9,14,16,19,21-23H,4-7,10-13,15,17-18H2/t19-,21?,22?,23-/m0/s1 |
| InChIKey | FSOHPYMGVJRJET-OZRWQMGGSA-N |
| XLogP | 6.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|