About (4-methoxycyclohexyl) benzoate
(4-methoxycyclohexyl) benzoate (PubChem CID 101493670) has the molecular formula C14H18O3
and a molecular weight of 234.30 g/mol. Its IUPAC name is (4-methoxycyclohexyl) benzoate.
Molecular Properties
| Compound Name | (4-methoxycyclohexyl) benzoate |
| PubChem CID | 101493670 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (4-methoxycyclohexyl) benzoate |
| SMILES | COC1CCC(OC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C14H18O3/c1-16-12-7-9-13(10-8-12)17-14(15)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3 |
| InChIKey | RKNLYFMBDNSPSP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methoxycyclohexyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxycyclohexyl) benzoate?
The IUPAC name of (4-methoxycyclohexyl) benzoate (CID 101493670) is (4-methoxycyclohexyl) benzoate.
What is the SMILES notation for (4-methoxycyclohexyl) benzoate?
The canonical SMILES for (4-methoxycyclohexyl) benzoate is COC1CCC(OC(=O)c2ccccc2)CC1.
What is the InChIKey of (4-methoxycyclohexyl) benzoate?
The InChIKey is RKNLYFMBDNSPSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-16-12-7-9-13(10-8-12)17-14(15)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3.
What are the key properties of (4-methoxycyclohexyl) benzoate?
(4-methoxycyclohexyl) benzoate has a molecular weight of 234.30 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxycyclohexyl) benzoate is sourced from PubChem (CID 101493670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).