About [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate
[4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate (PubChem CID 21014789) has the molecular formula C25H36O4
and a molecular weight of 400.56 g/mol. Its IUPAC name is [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate.
Molecular Properties
| Compound Name | [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate |
| PubChem CID | 21014789 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate |
| SMILES | COC1CCC(C(C)(C)C2CCC(OC(=O)c3cccc(C(C)=O)c3)CC2)CC1 |
| InChI | InChI=1S/C25H36O4/c1-17(26)18-6-5-7-19(16-18)24(27)29-23-14-10-21(11-15-23)25(2,3)20-8-12-22(28-4)13-9-20/h5-7,16,20-23H,8-15H2,1-4H3 |
| InChIKey | JUIUGHRALRYPNB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate?
The IUPAC name of [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate (CID 21014789) is [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate.
What is the SMILES notation for [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate?
The canonical SMILES for [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate is COC1CCC(C(C)(C)C2CCC(OC(=O)c3cccc(C(C)=O)c3)CC2)CC1.
What is the InChIKey of [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate?
The InChIKey is JUIUGHRALRYPNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36O4/c1-17(26)18-6-5-7-19(16-18)24(27)29-23-14-10-21(11-15-23)25(2,3)20-8-12-22(28-4)13-9-20/h5-7,16,20-23H,8-15H2,1-4H3.
What are the key properties of [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate?
[4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate has a molecular weight of 400.56 g/mol, XLogP of 5.84, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(4-methoxycyclohexyl)propan-2-yl]cyclohexyl] 3-acetylbenzoate is sourced from PubChem (CID 21014789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).