C20H28O4 — CID 91732085
3-O-(4-tert-butylcyclohexyl) 1-O-ethyl benzene-1,3-dicarboxylate (PubChem CID 91732085) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 3-O-(4-tert-butylcyclohexyl) 1-O-ethyl benzene-1,3-dicarboxylate.
| Compound Name | 3-O-(4-tert-butylcyclohexyl) 1-O-ethyl benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 91732085 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 3-O-(4-tert-butylcyclohexyl) 1-O-ethyl benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cccc(C(=O)OC2CCC(C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C20H28O4/c1-5-23-18(21)14-7-6-8-15(13-14)19(22)24-17-11-9-16(10-12-17)20(2,3)4/h6-8,13,16-17H,5,9-12H2,1-4H3 |
| InChIKey | VVUIPGBCVVHFEF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |