C26H34O4 — CID 3471491
(4-tert-butylcyclohexyl) 3-[(4-ethoxyphenoxy)methyl]benzoate (PubChem CID 3471491) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 3-[(4-ethoxyphenoxy)methyl]benzoate.
| Compound Name | (4-tert-butylcyclohexyl) 3-[(4-ethoxyphenoxy)methyl]benzoate |
|---|---|
| PubChem CID | 3471491 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (4-tert-butylcyclohexyl) 3-[(4-ethoxyphenoxy)methyl]benzoate |
| SMILES | CCOc1ccc(OCc2cccc(C(=O)OC3CCC(C(C)(C)C)CC3)c2)cc1 |
| InChI | InChI=1S/C26H34O4/c1-5-28-22-13-15-23(16-14-22)29-18-19-7-6-8-20(17-19)25(27)30-24-11-9-21(10-12-24)26(2,3)4/h6-8,13-17,21,24H,5,9-12,18H2,1-4H3 |
| InChIKey | QKYIVHMSKDFRSJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |