C19H28O4 — CID 173265590
(4-tert-butylcyclohexyl) 4-ethoxybenzenecarboperoxoate (PubChem CID 173265590) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 4-ethoxybenzenecarboperoxoate.
| Compound Name | (4-tert-butylcyclohexyl) 4-ethoxybenzenecarboperoxoate |
|---|---|
| PubChem CID | 173265590 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (4-tert-butylcyclohexyl) 4-ethoxybenzenecarboperoxoate |
| SMILES | CCOc1ccc(C(=O)OOC2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H28O4/c1-5-21-16-10-6-14(7-11-16)18(20)23-22-17-12-8-15(9-13-17)19(2,3)4/h6-7,10-11,15,17H,5,8-9,12-13H2,1-4H3 |
| InChIKey | SCZWJHFJRQQAJG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|