C18H26O4 — CID 173265506
(4-tert-butylcyclohexyl) 4-methoxybenzenecarboperoxoate (PubChem CID 173265506) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 4-methoxybenzenecarboperoxoate.
| Compound Name | (4-tert-butylcyclohexyl) 4-methoxybenzenecarboperoxoate |
|---|---|
| PubChem CID | 173265506 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (4-tert-butylcyclohexyl) 4-methoxybenzenecarboperoxoate |
| SMILES | COc1ccc(C(=O)OOC2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H26O4/c1-18(2,3)14-7-11-16(12-8-14)21-22-17(19)13-5-9-15(20-4)10-6-13/h5-6,9-10,14,16H,7-8,11-12H2,1-4H3 |
| InChIKey | JGNUQICGDLDSDX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|