C24H35NO3 — CID 41307097
[1-(4-tert-butylcyclohexanecarbonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone (PubChem CID 41307097) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is [1-(4-tert-butylcyclohexanecarbonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [1-(4-tert-butylcyclohexanecarbonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 41307097 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | [1-(4-tert-butylcyclohexanecarbonyl)piperidin-4-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2CCN(C(=O)C3CCC(C(C)(C)C)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H35NO3/c1-24(2,3)20-9-5-19(6-10-20)23(27)25-15-13-18(14-16-25)22(26)17-7-11-21(28-4)12-8-17/h7-8,11-12,18-20H,5-6,9-10,13-16H2,1-4H3 |
| InChIKey | RBYQEGNMDZUVOQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |