About [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate
[4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate (PubChem CID 170254641) has the molecular formula C26H26O6
and a molecular weight of 434.49 g/mol. Its IUPAC name is [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate.
Molecular Properties
| Compound Name | [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate |
| PubChem CID | 170254641 |
| Molecular Formula | C26H26O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OC(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H26O6/c1-5-29-20-10-6-18(7-11-20)24(27)30-21-14-16-22(17-15-21)31-25(28)19-8-12-23(13-9-19)32-26(2,3)4/h6-17H,5H2,1-4H3 |
| InChIKey | BZFNHKSOMDOMSU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate?
The IUPAC name of [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate (CID 170254641) is [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate.
What is the SMILES notation for [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate?
The canonical SMILES for [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate is CCOc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OC(C)(C)C)cc3)cc2)cc1.
What is the InChIKey of [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate?
The InChIKey is BZFNHKSOMDOMSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26O6/c1-5-29-20-10-6-18(7-11-20)24(27)30-21-14-16-22(17-15-21)31-25(28)19-8-12-23(13-9-19)32-26(2,3)4/h6-17H,5H2,1-4H3.
What are the key properties of [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate?
[4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate has a molecular weight of 434.49 g/mol, XLogP of 5.70, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-[(2-methylpropan-2-yl)oxy]benzoyl]oxyphenyl] 4-ethoxybenzoate is sourced from PubChem (CID 170254641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).